Products 1823075-44-0
CAS 1823075-44-0 is the registry number for 3-Bromo-4-nitrobenzenethiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-bromo-4-nitrobenzenethiol (CAS 1823075-44-0) is a chemical compound with the molecular formula C6H4BrNO2S and a molecular weight of 234.07 g/mol. IUPAC name: 3-bromo-4-nitrobenzenethiol. InChIKey: LOXRQVIVWMSVBL-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO2S |
|---|---|
| Molecular weight | 234.07 g/mol |
| IUPAC name | 3-bromo-4-nitrobenzenethiol |
| InChIKey | LOXRQVIVWMSVBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)