Products 103582-31-6
CAS 103582-31-6 appears in our catalog under these names: 2-(2-Nitrobenzylidene)malonic acid, 95%, 2-(2-Nitrobenzylidene)malonic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-[(2-nitrophenyl)methylidene]propanedioic acid (CAS 103582-31-6) is a chemical compound with the molecular formula C10H7NO6 and a molecular weight of 237.17 g/mol. IUPAC name: 2-[(2-nitrophenyl)methylidene]propanedioic acid. InChIKey: PWOSYAXUKPDKHQ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO6 |
|---|---|
| Molecular weight | 237.17 g/mol |
| IUPAC name | 2-[(2-nitrophenyl)methylidene]propanedioic acid |
| InChIKey | PWOSYAXUKPDKHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=C(C(=O)O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)