CAS 6315-90-8 appears in our catalog under these names: 4,5-Methylenedioxy-2-nitrocinnamic acid, 98%, 3,4-(Methylenedioxy)-6-nitrocinnamic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 25g, 5g.
(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoic acid (CAS 6315-90-8) is a chemical compound with the molecular formula C10H7NO6 and a molecular weight of 237.17 g/mol. IUPAC name: (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoic acid. InChIKey: GJAIAEVUUHUHTE-OWOJBTEDSA-N.
| Molecular formula | C10H7NO6 |
|---|---|
| Molecular weight | 237.17 g/mol |
| IUPAC name | (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoic acid |
| InChIKey | GJAIAEVUUHUHTE-OWOJBTEDSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)/C=C/C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)