CAS 205680-83-7 appears in our catalog under these names: 2-(3-Hydroxycarbonyl-2-nitrophenyl)malondialdehyde, 95%, 2-(3-Hydroxycarbonyl-2-nitrophenyl)malondialdehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
3-(1,3-dioxopropan-2-yl)-2-nitrobenzoic acid (CAS 205680-83-7) is a chemical compound with the molecular formula C10H7NO6 and a molecular weight of 237.17 g/mol. IUPAC name: 3-(1,3-dioxopropan-2-yl)-2-nitrobenzoic acid. InChIKey: WHFZKCYOFGVOLR-UHFFFAOYSA-N.
| Molecular formula | C10H7NO6 |
|---|---|
| Molecular weight | 237.17 g/mol |
| IUPAC name | 3-(1,3-dioxopropan-2-yl)-2-nitrobenzoic acid |
| InChIKey | WHFZKCYOFGVOLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)O)[N+](=O)[O-])C(C=O)C=O |
Computed by PubChem (NCBI)