CAS 1035912-44-7 is the registry number for 5,6-Dimethyl-9-oxo-9H-xanthene-4-acetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 500mg.
Methyl 2-(5,6-dimethyl-9-oxoxanthen-4-yl)acetate (CAS 1035912-44-7) is a chemical compound with the molecular formula C18H16O4 and a molecular weight of 296.3 g/mol. IUPAC name: methyl 2-(5,6-dimethyl-9-oxoxanthen-4-yl)acetate. InChIKey: RMQUMATZQHPMBA-UHFFFAOYSA-N.
| Molecular formula | C18H16O4 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | methyl 2-(5,6-dimethyl-9-oxoxanthen-4-yl)acetate |
| InChIKey | RMQUMATZQHPMBA-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C3=CC=CC(=C3O2)CC(=O)OC)C |
Computed by PubChem (NCBI)