Products 103614-68-2
CAS 103614-68-2 is the registry number for 4-Hydroxyscytalone. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,4,6,8-tetrahydroxy-3,4-dihydro-2H-naphthalen-1-one (CAS 103614-68-2) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 3,4,6,8-tetrahydroxy-3,4-dihydro-2H-naphthalen-1-one. InChIKey: BHKWJBLOULPVEY-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 3,4,6,8-tetrahydroxy-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | BHKWJBLOULPVEY-UHFFFAOYSA-N |
| SMILES | C1C(C(C2=C(C1=O)C(=CC(=C2)O)O)O)O |
Computed by PubChem (NCBI)