Products 103629-87-4
CAS 103629-87-4 is the registry number for Daucoidin A. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, Get quote.
2-[(8S,9R)-9-hydroxy-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl (Z)-2-methylbut-2-enoate (CAS 103629-87-4) is a chemical compound with the molecular formula C19H20O6 and a molecular weight of 344.4 g/mol. IUPAC name: 2-[(8S,9R)-9-hydroxy-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl (Z)-2-methylbut-2-enoate. InChIKey: GZAQAICYIHWIAX-IJOJBTCESA-N.
| Molecular formula | C19H20O6 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-[(8S,9R)-9-hydroxy-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl (Z)-2-methylbut-2-enoate |
| InChIKey | GZAQAICYIHWIAX-IJOJBTCESA-N |
| SMILES | C/C=C(/C)\C(=O)OC(C)(C)[C@@H]1[C@@H](C2=C(O1)C=CC3=C2OC(=O)C=C3)O |
Computed by PubChem (NCBI)