CAS 3539-42-2 appears in our catalog under these names: 4,4'-Isopropylidenediphenoxyacetic acid, 95%, 2,2'-((Propane-2,2-diylbis(4,1-phenylene))bis(oxy))diacetic acid, 97%, 4,4'–Isopropylidenediphenoxyacetic Acid, 4,4'-Isopropylidenediphenoxyacetic Acid, >98.0%(HPLC)(T), 4,4'-Isopropylidenediphenoxyacetic Acid, 98.0%, 98.0%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 10g, 1g, 5g, 25g.
2-[4-[2-[4-(carboxymethoxy)phenyl]propan-2-yl]phenoxy]acetic acid (CAS 3539-42-2) is a chemical compound with the molecular formula C19H20O6 and a molecular weight of 344.4 g/mol. IUPAC name: 2-[4-[2-[4-(carboxymethoxy)phenyl]propan-2-yl]phenoxy]acetic acid. InChIKey: ZYGPJSLWIIMUMO-UHFFFAOYSA-N.
| Molecular formula | C19H20O6 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-[4-[2-[4-(carboxymethoxy)phenyl]propan-2-yl]phenoxy]acetic acid |
| InChIKey | ZYGPJSLWIIMUMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OCC(=O)O)C2=CC=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)