Products 162283-70-7
CAS 162283-70-7 is the registry number for propionylshikonin. Offered by: GLPBio. Available pack sizes: 10mg.
[(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] propanoate (CAS 162283-70-7) is a chemical compound with the molecular formula C19H20O6 and a molecular weight of 344.4 g/mol. IUPAC name: [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] propanoate. InChIKey: DLBQFLWCDFTEQG-OAHLLOKOSA-N.
| Molecular formula | C19H20O6 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] propanoate |
| InChIKey | DLBQFLWCDFTEQG-OAHLLOKOSA-N |
| SMILES | CCC(=O)O[C@H](CC=C(C)C)C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O |
Computed by PubChem (NCBI)