CAS 1036381-92-6 is the registry number for tert-Butyl 3-bromo-2-oxo-1,2,7,8-tetrahydro-1,6-naphthyridine-6(5H)-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
Tert-butyl 3-bromo-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate (CAS 1036381-92-6) is a chemical compound with the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. IUPAC name: tert-butyl 3-bromo-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate. InChIKey: ZAZWMOVLWWDQHH-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O3 |
|---|---|
| Molecular weight | 329.19 g/mol |
| IUPAC name | tert-butyl 3-bromo-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate |
| InChIKey | ZAZWMOVLWWDQHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(C(=O)N2)Br |
Computed by PubChem (NCBI)