CAS 1387533-90-5 appears in our catalog under these names: tert-Butyl n-([(3-bromophenyl)carbamoyl]methyl)carbamate, 95%, tert-Butyl N-{((3-bromophenyl)carbamoyl)methyl}carbamate, 95%, tert-Butyl N-{((3-bromophenyl)carbamoyl)methyl}carbamate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg.
Tert-butyl N-[2-(3-bromoanilino)-2-oxoethyl]carbamate (CAS 1387533-90-5) is a chemical compound with the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. IUPAC name: tert-butyl N-[2-(3-bromoanilino)-2-oxoethyl]carbamate. InChIKey: MBUXONDDHXTEKD-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O3 |
|---|---|
| Molecular weight | 329.19 g/mol |
| IUPAC name | tert-butyl N-[2-(3-bromoanilino)-2-oxoethyl]carbamate |
| InChIKey | MBUXONDDHXTEKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NC1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)