Products 2750612-90-7
CAS 2750612-90-7 is the registry number for tert-Butyl 7-bromo-2-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-bromo-2-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate (CAS 2750612-90-7) is a chemical compound with the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. IUPAC name: tert-butyl 7-bromo-2-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate. InChIKey: GHKJZCDTPRSLNA-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O3 |
|---|---|
| Molecular weight | 329.19 g/mol |
| IUPAC name | tert-butyl 7-bromo-2-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate |
| InChIKey | GHKJZCDTPRSLNA-UHFFFAOYSA-N |
| SMILES | CC1COC2=C(N1C(=O)OC(C)(C)C)C=C(C=N2)Br |
Computed by PubChem (NCBI)