Products 1036396-41-4
CAS 1036396-41-4 is the registry number for 3-(2,5-Difluoro-4-(trifluoromethyl)phenyl)propanal, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[2,5-difluoro-4-(trifluoromethyl)phenyl]propanal (CAS 1036396-41-4) is a chemical compound with the molecular formula C10H7F5O and a molecular weight of 238.15 g/mol. IUPAC name: 3-[2,5-difluoro-4-(trifluoromethyl)phenyl]propanal. InChIKey: IFHMNZWVCWWYBR-UHFFFAOYSA-N.
| Molecular formula | C10H7F5O |
|---|---|
| Molecular weight | 238.15 g/mol |
| IUPAC name | 3-[2,5-difluoro-4-(trifluoromethyl)phenyl]propanal |
| InChIKey | IFHMNZWVCWWYBR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)C(F)(F)F)F)CCC=O |
Computed by PubChem (NCBI)