CAS 2091735-09-8 appears in our catalog under these names: 1-[4-(1,1-Difluoroethyl)phenyl]-2,2,2-trifluoroethanone, 95%, 1-(4-(1,1-Difluoroethyl)phenyl)-2,2,2-trifluoroethan-1-one, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg.
1-[4-(1,1-difluoroethyl)phenyl]-2,2,2-trifluoroethanone (CAS 2091735-09-8) is a chemical compound with the molecular formula C10H7F5O and a molecular weight of 238.15 g/mol. IUPAC name: 1-[4-(1,1-difluoroethyl)phenyl]-2,2,2-trifluoroethanone. InChIKey: KYDCTHRXLWPKFD-UHFFFAOYSA-N.
| Molecular formula | C10H7F5O |
|---|---|
| Molecular weight | 238.15 g/mol |
| IUPAC name | 1-[4-(1,1-difluoroethyl)phenyl]-2,2,2-trifluoroethanone |
| InChIKey | KYDCTHRXLWPKFD-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(=O)C(F)(F)F)(F)F |
Computed by PubChem (NCBI)