Products 1823859-75-1
CAS 1823859-75-1 is the registry number for 2,2-Difluoro-1-(2-methyl-3-(trifluoromethyl)phenyl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2,2-difluoro-1-[2-methyl-3-(trifluoromethyl)phenyl]ethanone (CAS 1823859-75-1) is a chemical compound with the molecular formula C10H7F5O and a molecular weight of 238.15 g/mol. IUPAC name: 2,2-difluoro-1-[2-methyl-3-(trifluoromethyl)phenyl]ethanone. InChIKey: KTCNRSGYHCQKPL-UHFFFAOYSA-N.
| Molecular formula | C10H7F5O |
|---|---|
| Molecular weight | 238.15 g/mol |
| IUPAC name | 2,2-difluoro-1-[2-methyl-3-(trifluoromethyl)phenyl]ethanone |
| InChIKey | KTCNRSGYHCQKPL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1C(F)(F)F)C(=O)C(F)F |
Computed by PubChem (NCBI)