CAS 1036441-42-5 appears in our catalog under these names: 2-(2,5-Dimethyl-1H-pyrrol-1-yl)-5-methylbenzoic acid, 95%, 2-(2,5-Dimethyl-1H-pyrrol-1-yl)-5-methylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(2,5-dimethylpyrrol-1-yl)-5-methylbenzoic acid (CAS 1036441-42-5) is a chemical compound with the molecular formula C14H15NO2 and a molecular weight of 229.27 g/mol. IUPAC name: 2-(2,5-dimethylpyrrol-1-yl)-5-methylbenzoic acid. InChIKey: UPJXJUMMLBLTDO-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 2-(2,5-dimethylpyrrol-1-yl)-5-methylbenzoic acid |
| InChIKey | UPJXJUMMLBLTDO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=CC=C2C)C)C(=O)O |
Computed by PubChem (NCBI)