CAS 1036501-57-1 is the registry number for 1-(2-Cyanophenyl)-N,N-dimethylmethanesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(2-cyanophenyl)-N,N-dimethylmethanesulfonamide (CAS 1036501-57-1) is a chemical compound with the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. IUPAC name: 1-(2-cyanophenyl)-N,N-dimethylmethanesulfonamide. InChIKey: AJIOVWCXNVGHOC-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | 1-(2-cyanophenyl)-N,N-dimethylmethanesulfonamide |
| InChIKey | AJIOVWCXNVGHOC-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)CC1=CC=CC=C1C#N |
Computed by PubChem (NCBI)