Products 891755-28-5
CAS 891755-28-5 appears in our catalog under these names: 3-tert-Butylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid, 95%, 3–tert–Butylimidazo(2，1–b)(1，3)thiazole–6–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
3-tert-butylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid (CAS 891755-28-5) is a chemical compound with the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. IUPAC name: 3-tert-butylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid. InChIKey: XQVDKPOJYPVQKX-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | 3-tert-butylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
| InChIKey | XQVDKPOJYPVQKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CSC2=NC(=CN12)C(=O)O |
Computed by PubChem (NCBI)