CAS 1637781-47-5 is the registry number for 2,2-Dimethyl-7-nitro-3,4-dihydro-2h-1,4-benzothiazine, 97%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,2-dimethyl-7-nitro-3,4-dihydro-1,4-benzothiazine (CAS 1637781-47-5) is a chemical compound with the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. IUPAC name: 2,2-dimethyl-7-nitro-3,4-dihydro-1,4-benzothiazine. InChIKey: ORTVZBCRHXFSID-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | 2,2-dimethyl-7-nitro-3,4-dihydro-1,4-benzothiazine |
| InChIKey | ORTVZBCRHXFSID-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=C(S1)C=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)