Products 1036512-83-0
CAS 1036512-83-0 is the registry number for 3-(3-Cyclopropyl-1,2,4-oxadiazol-5-yl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)aniline (CAS 1036512-83-0) is a chemical compound with the molecular formula C11H11N3O and a molecular weight of 201.22 g/mol. IUPAC name: 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)aniline. InChIKey: UWYNESDENROIHG-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)aniline |
| InChIKey | UWYNESDENROIHG-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NOC(=N2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)