Products 1036648-06-2

CAS 1036648-06-2 is the registry number for 4-Chloro-2-pyridinecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-chloropyridine-2-carboxylic acid;hydrochloride (CAS 1036648-06-2) is a chemical compound with the molecular formula C6H5Cl2NO2 and a molecular weight of 194.01 g/mol. IUPAC name: 4-chloropyridine-2-carboxylic acid;hydrochloride. InChIKey: SZPWZVJHTRDNHG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5Cl2NO2
Molecular weight194.01 g/mol
IUPAC name4-chloropyridine-2-carboxylic acid;hydrochloride
InChIKeySZPWZVJHTRDNHG-UHFFFAOYSA-N
SMILESC1=CN=C(C=C1Cl)C(=O)O.Cl

Computed by PubChem (NCBI)