Products 24691-30-3

CAS 24691-30-3 appears in our catalog under these names: 3,4-Dichloro-5-methylpyrrole-2-carboxylic acid, 3,4-Dichloro-5-methyl-1H-pyrrole-2-carboxylic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 1g, 2g, 5g, 10g, 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

3,4-dichloro-5-methyl-1H-pyrrole-2-carboxylic acid (CAS 24691-30-3) is a chemical compound with the molecular formula C6H5Cl2NO2 and a molecular weight of 194.01 g/mol. IUPAC name: 3,4-dichloro-5-methyl-1H-pyrrole-2-carboxylic acid. InChIKey: HIXZMJPBUJFSPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5Cl2NO2
Molecular weight194.01 g/mol
IUPAC name3,4-dichloro-5-methyl-1H-pyrrole-2-carboxylic acid
InChIKeyHIXZMJPBUJFSPJ-UHFFFAOYSA-N
SMILESCC1=C(C(=C(N1)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)