Products 1937252-96-4
CAS 1937252-96-4 is the registry number for Etoricoxib Impurity 39. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-2-chloro-3-[[(Z)-2-chloro-3-oxoprop-1-enyl]amino]prop-2-enal (CAS 1937252-96-4) is a chemical compound with the molecular formula C6H5Cl2NO2 and a molecular weight of 194.01 g/mol. IUPAC name: (Z)-2-chloro-3-[[(Z)-2-chloro-3-oxoprop-1-enyl]amino]prop-2-enal. InChIKey: AFLWUYFTLUHPND-IOBHVTPZSA-N.
| Molecular formula | C6H5Cl2NO2 |
|---|---|
| Molecular weight | 194.01 g/mol |
| IUPAC name | (Z)-2-chloro-3-[[(Z)-2-chloro-3-oxoprop-1-enyl]amino]prop-2-enal |
| InChIKey | AFLWUYFTLUHPND-IOBHVTPZSA-N |
| SMILES | C(=C(\Cl)/C=O)\N/C=C(\Cl)/C=O |
Computed by PubChem (NCBI)