Products 1037082-29-3
CAS 1037082-29-3 is the registry number for tert-Butyl 2-bromo-5-nitrobenzyl(methyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl N-[(2-bromo-5-nitrophenyl)methyl]-N-methylcarbamate (CAS 1037082-29-3) is a chemical compound with the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. IUPAC name: tert-butyl N-[(2-bromo-5-nitrophenyl)methyl]-N-methylcarbamate. InChIKey: WMVHFZQUFKVILJ-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O4 |
|---|---|
| Molecular weight | 345.19 g/mol |
| IUPAC name | tert-butyl N-[(2-bromo-5-nitrophenyl)methyl]-N-methylcarbamate |
| InChIKey | WMVHFZQUFKVILJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CC1=C(C=CC(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)