CAS 656801-30-8 is the registry number for (S)-3-(5-Bromopyridin-2-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
(2S)-3-(5-bromo-2-pyridinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 656801-30-8) is a chemical compound with the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. IUPAC name: (2S)-3-(5-bromo-2-pyridinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: QBYRPIJAOSCCEY-JTQLQIEISA-N.
| Molecular formula | C13H17BrN2O4 |
|---|---|
| Molecular weight | 345.19 g/mol |
| IUPAC name | (2S)-3-(5-bromo-2-pyridinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | QBYRPIJAOSCCEY-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=NC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)