CAS 1379891-42-5 is the registry number for 3-(6-Bromopyridin-3-yl)-2-{((tert-butoxy)carbonyl)amino}propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(6-bromo-3-pyridinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1379891-42-5) is a chemical compound with the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. IUPAC name: 3-(6-bromo-3-pyridinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: WMWLTWBDPDLKHY-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O4 |
|---|---|
| Molecular weight | 345.19 g/mol |
| IUPAC name | 3-(6-bromo-3-pyridinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | WMWLTWBDPDLKHY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CN=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)