Products 1037130-74-7

CAS 1037130-74-7 is the registry number for Methyl 4-(2,6-difluorophenyl)-2,4-dioxobutanoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

Methyl 4-(2,6-difluorophenyl)-2,4-dioxobutanoate (CAS 1037130-74-7) is a chemical compound with the molecular formula C11H8F2O4 and a molecular weight of 242.17 g/mol. IUPAC name: methyl 4-(2,6-difluorophenyl)-2,4-dioxobutanoate. InChIKey: SINDSIHKSFOEOX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8F2O4
Molecular weight242.17 g/mol
IUPAC namemethyl 4-(2,6-difluorophenyl)-2,4-dioxobutanoate
InChIKeySINDSIHKSFOEOX-UHFFFAOYSA-N
SMILESCOC(=O)C(=O)CC(=O)C1=C(C=CC=C1F)F

Computed by PubChem (NCBI)