CAS 1037130-74-7 is the registry number for Methyl 4-(2,6-difluorophenyl)-2,4-dioxobutanoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 4-(2,6-difluorophenyl)-2,4-dioxobutanoate (CAS 1037130-74-7) is a chemical compound with the molecular formula C11H8F2O4 and a molecular weight of 242.17 g/mol. IUPAC name: methyl 4-(2,6-difluorophenyl)-2,4-dioxobutanoate. InChIKey: SINDSIHKSFOEOX-UHFFFAOYSA-N.
| Molecular formula | C11H8F2O4 |
|---|---|
| Molecular weight | 242.17 g/mol |
| IUPAC name | methyl 4-(2,6-difluorophenyl)-2,4-dioxobutanoate |
| InChIKey | SINDSIHKSFOEOX-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=C(C=CC=C1F)F |
Computed by PubChem (NCBI)