CAS 175711-74-7 appears in our catalog under these names: Methyl 4-(2,5-difluorophenyl)-2,4-dioxobutanoate, 95%, Methyl 4-(2,5-difluorophenyl)-2,4-dioxobutanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
Methyl 4-(2,5-difluorophenyl)-2,4-dioxobutanoate (CAS 175711-74-7) is a chemical compound with the molecular formula C11H8F2O4 and a molecular weight of 242.17 g/mol. IUPAC name: methyl 4-(2,5-difluorophenyl)-2,4-dioxobutanoate. InChIKey: HCEHCVYYRVQQLB-UHFFFAOYSA-N.
| Molecular formula | C11H8F2O4 |
|---|---|
| Molecular weight | 242.17 g/mol |
| IUPAC name | methyl 4-(2,5-difluorophenyl)-2,4-dioxobutanoate |
| InChIKey | HCEHCVYYRVQQLB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=C(C=CC(=C1)F)F |
Computed by PubChem (NCBI)