Products 2387607-47-6
CAS 2387607-47-6 is the registry number for 2,6-difluoro-4-[(E)-3-methoxy-3-oxo-prop-1-enyl]benzoic acid, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2,6-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]benzoic acid (CAS 2387607-47-6) is a chemical compound with the molecular formula C11H8F2O4 and a molecular weight of 242.17 g/mol. IUPAC name: 2,6-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]benzoic acid. InChIKey: YHARIIBCUJTCTJ-NSCUHMNNSA-N.
| Molecular formula | C11H8F2O4 |
|---|---|
| Molecular weight | 242.17 g/mol |
| IUPAC name | 2,6-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]benzoic acid |
| InChIKey | YHARIIBCUJTCTJ-NSCUHMNNSA-N |
| SMILES | COC(=O)/C=C/C1=CC(=C(C(=C1)F)C(=O)O)F |
Computed by PubChem (NCBI)