Products 1037157-39-3
CAS 1037157-39-3 is the registry number for (5-Bromo-2-(2,2,2-trifluoroethoxy)phenyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]methanol (CAS 1037157-39-3) is a chemical compound with the molecular formula C9H8BrF3O2 and a molecular weight of 285.06 g/mol. IUPAC name: [5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]methanol. InChIKey: BRLQEMNSIJBNGV-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O2 |
|---|---|
| Molecular weight | 285.06 g/mol |
| IUPAC name | [5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]methanol |
| InChIKey | BRLQEMNSIJBNGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CO)OCC(F)(F)F |
Computed by PubChem (NCBI)