CAS 1037301-10-2 is the registry number for Butyl (S)-3-aminotetrahydrofuran-3-carboxylate (S)-2-hydroxy-2-phenylacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Butyl (3S)-3-aminooxolane-3-carboxylate;(2S)-2-hydroxy-2-phenylacetic acid (CAS 1037301-10-2) is a chemical compound with the molecular formula C17H25NO6 and a molecular weight of 339.4 g/mol. IUPAC name: butyl (3S)-3-aminooxolane-3-carboxylate;(2S)-2-hydroxy-2-phenylacetic acid. InChIKey: SNTYUUVQBZZCPV-ANNIYNITSA-N.
| Molecular formula | C17H25NO6 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | butyl (3S)-3-aminooxolane-3-carboxylate;(2S)-2-hydroxy-2-phenylacetic acid |
| InChIKey | SNTYUUVQBZZCPV-ANNIYNITSA-N |
| SMILES | CCCCOC(=O)[C@@]1(CCOC1)N.C1=CC=C(C=C1)[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)