Products 1260614-50-3
CAS 1260614-50-3 is the registry number for (R)-3-((tert-Butoxycarbonyl)amino)-2-(2,4-dimethoxybenzyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[(2,4-dimethoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1260614-50-3) is a chemical compound with the molecular formula C17H25NO6 and a molecular weight of 339.4 g/mol. IUPAC name: (2R)-2-[(2,4-dimethoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: MVPCYWLWXMSRMB-GFCCVEGCSA-N.
| Molecular formula | C17H25NO6 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | (2R)-2-[(2,4-dimethoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | MVPCYWLWXMSRMB-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](CC1=C(C=C(C=C1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)