Products 2447066-51-3
CAS 2447066-51-3 is the registry number for tert-Butyl 3-hydroxy-3-(3,4,5-trimethoxyphenyl)azetidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-hydroxy-3-(3,4,5-trimethoxyphenyl)azetidine-1-carboxylate (CAS 2447066-51-3) is a chemical compound with the molecular formula C17H25NO6 and a molecular weight of 339.4 g/mol. IUPAC name: tert-butyl 3-hydroxy-3-(3,4,5-trimethoxyphenyl)azetidine-1-carboxylate. InChIKey: UCNYXSNGIFZEOJ-UHFFFAOYSA-N.
| Molecular formula | C17H25NO6 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | tert-butyl 3-hydroxy-3-(3,4,5-trimethoxyphenyl)azetidine-1-carboxylate |
| InChIKey | UCNYXSNGIFZEOJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C2=CC(=C(C(=C2)OC)OC)OC)O |
Computed by PubChem (NCBI)