Products 1037493-25-6
CAS 1037493-25-6 is the registry number for 4–chloro–2–(p–tolylethynyl)aniline. Offered by: GLPBio. Available pack sizes: 1g, 250mg, 5g.
4-chloro-2-[2-(4-methylphenyl)ethynyl]aniline (CAS 1037493-25-6) is a chemical compound with the molecular formula C15H12ClN and a molecular weight of 241.71 g/mol. IUPAC name: 4-chloro-2-[2-(4-methylphenyl)ethynyl]aniline. InChIKey: BRSYQTXPIQOVKG-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | 4-chloro-2-[2-(4-methylphenyl)ethynyl]aniline |
| InChIKey | BRSYQTXPIQOVKG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C#CC2=C(C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)