CAS 2296737-09-0 is the registry number for 2-(3-Chlorophenyl)-1-methyl-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chlorophenyl)-1-methylindole (CAS 2296737-09-0) is a chemical compound with the molecular formula C15H12ClN and a molecular weight of 241.71 g/mol. IUPAC name: 2-(3-chlorophenyl)-1-methylindole. InChIKey: AITWTGNRJXASCF-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1-methylindole |
| InChIKey | AITWTGNRJXASCF-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C=C1C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)