CAS 92433-38-0 is the registry number for 1-Benzyl-5-chloro-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g.
1-benzyl-5-chloroindole (CAS 92433-38-0) is a chemical compound with the molecular formula C15H12ClN and a molecular weight of 241.71 g/mol. IUPAC name: 1-benzyl-5-chloroindole. InChIKey: IZIBDDKCIGGIOJ-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | 1-benzyl-5-chloroindole |
| InChIKey | IZIBDDKCIGGIOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC3=C2C=CC(=C3)Cl |
Computed by PubChem (NCBI)