Products 1037560-78-3

CAS 1037560-78-3 is the registry number for (Thiazol-2-ylcarbamoylmethyl)-carbamic acid tert-butyl ester, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Tert-butyl N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]carbamate (CAS 1037560-78-3) is a chemical compound with the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. IUPAC name: tert-butyl N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]carbamate. InChIKey: MRGBEMMYRJXTDM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15N3O3S
Molecular weight257.31 g/mol
IUPAC nametert-butyl N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]carbamate
InChIKeyMRGBEMMYRJXTDM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC(=O)NC1=NC=CS1

Computed by PubChem (NCBI)