Products 926207-71-8
CAS 926207-71-8 is the registry number for 1-((3,5-Dimethyl-1H-pyrazol-4-yl)sulfonyl)piperidin-4-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-one (CAS 926207-71-8) is a chemical compound with the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. IUPAC name: 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-one. InChIKey: ZMKBTVNCRNDVEU-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O3S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-one |
| InChIKey | ZMKBTVNCRNDVEU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)S(=O)(=O)N2CCC(=O)CC2 |
Computed by PubChem (NCBI)