CAS 326023-25-0 appears in our catalog under these names: 4-(Morpholine-4-sulfonyl)-benzene-1,2-diamine, 95%, 4-(Morpholine-4-sulfonyl)benzene-1,2-diamine, 98%, 4-(Morpholine-4-sulfonyl)benzene-1,2-diamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 50mg, 0,5g.
4-morpholin-4-ylsulfonylbenzene-1,2-diamine (CAS 326023-25-0) is a chemical compound with the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. IUPAC name: 4-morpholin-4-ylsulfonylbenzene-1,2-diamine. InChIKey: ZYTBMQIKJPRMON-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O3S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 4-morpholin-4-ylsulfonylbenzene-1,2-diamine |
| InChIKey | ZYTBMQIKJPRMON-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)