CAS 103788-64-3 appears in our catalog under these names: Methyl 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate, 95%, Methyl 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 500mg, 250mg.
Methyl 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate (CAS 103788-64-3) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: methyl 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate. InChIKey: UDWQWRFEUXUBHR-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | methyl 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate |
| InChIKey | UDWQWRFEUXUBHR-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CC=C2)CC(=O)OC |
Computed by PubChem (NCBI)