CAS 5987-00-8 is the registry number for 4-(2,5-Dimethyl-1H-pyrrol-1-yl)-2-hydroxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
4-(2,5-dimethylpyrrol-1-yl)-2-hydroxybenzoic acid (CAS 5987-00-8) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: 4-(2,5-dimethylpyrrol-1-yl)-2-hydroxybenzoic acid. InChIKey: WAYCNXGAKFXIKA-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 4-(2,5-dimethylpyrrol-1-yl)-2-hydroxybenzoic acid |
| InChIKey | WAYCNXGAKFXIKA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC(=C(C=C2)C(=O)O)O)C |
Computed by PubChem (NCBI)