Products 1038311-61-3

CAS 1038311-61-3 is the registry number for 3-(4-(Difluoromethoxy)phenyl)isoxazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[4-(difluoromethoxy)phenyl]-1,2-oxazole-5-carboxylic acid (CAS 1038311-61-3) is a chemical compound with the molecular formula C11H7F2NO4 and a molecular weight of 255.17 g/mol. IUPAC name: 3-[4-(difluoromethoxy)phenyl]-1,2-oxazole-5-carboxylic acid. InChIKey: QRXYIIZNIDMSNG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7F2NO4
Molecular weight255.17 g/mol
IUPAC name3-[4-(difluoromethoxy)phenyl]-1,2-oxazole-5-carboxylic acid
InChIKeyQRXYIIZNIDMSNG-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NOC(=C2)C(=O)O)OC(F)F

Computed by PubChem (NCBI)