Products 1531925-91-3

CAS 1531925-91-3 is the registry number for 2,4-Difluoro-benzoic acid 2,5-dioxo-pyrrolidin-1-yl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 2,4-difluorobenzoate (CAS 1531925-91-3) is a chemical compound with the molecular formula C11H7F2NO4 and a molecular weight of 255.17 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2,4-difluorobenzoate. InChIKey: KSODCAWWRQVXNB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7F2NO4
Molecular weight255.17 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 2,4-difluorobenzoate
InChIKeyKSODCAWWRQVXNB-UHFFFAOYSA-N
SMILESC1CC(=O)N(C1=O)OC(=O)C2=C(C=C(C=C2)F)F

Computed by PubChem (NCBI)