Products 932917-90-3

CAS 932917-90-3 is the registry number for 5-((2,4-Difluorophenoxy)methyl)-1,2-oxazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-[(2,4-difluorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid (CAS 932917-90-3) is a chemical compound with the molecular formula C11H7F2NO4 and a molecular weight of 255.17 g/mol. IUPAC name: 5-[(2,4-difluorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid. InChIKey: MEAKHCHVZCABQN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7F2NO4
Molecular weight255.17 g/mol
IUPAC name5-[(2,4-difluorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid
InChIKeyMEAKHCHVZCABQN-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)F)OCC2=CC(=NO2)C(=O)O

Computed by PubChem (NCBI)