CAS 932917-90-3 is the registry number for 5-((2,4-Difluorophenoxy)methyl)-1,2-oxazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(2,4-difluorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid (CAS 932917-90-3) is a chemical compound with the molecular formula C11H7F2NO4 and a molecular weight of 255.17 g/mol. IUPAC name: 5-[(2,4-difluorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid. InChIKey: MEAKHCHVZCABQN-UHFFFAOYSA-N.
| Molecular formula | C11H7F2NO4 |
|---|---|
| Molecular weight | 255.17 g/mol |
| IUPAC name | 5-[(2,4-difluorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid |
| InChIKey | MEAKHCHVZCABQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)OCC2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)