CAS 1038358-01-8 is the registry number for 3-(3-Phenoxyphenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-phenoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 1038358-01-8) is a chemical compound with the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. IUPAC name: 3-(3-phenoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: XAVUQPLDKATBHZ-UHFFFAOYSA-N.
| Molecular formula | C16H13NO4 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | 3-(3-phenoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | XAVUQPLDKATBHZ-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=CC(=CC=C2)OC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)