Products 1038358-01-8

CAS 1038358-01-8 is the registry number for 3-(3-Phenoxyphenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(3-phenoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 1038358-01-8) is a chemical compound with the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. IUPAC name: 3-(3-phenoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: XAVUQPLDKATBHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13NO4
Molecular weight283.28 g/mol
IUPAC name3-(3-phenoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid
InChIKeyXAVUQPLDKATBHZ-UHFFFAOYSA-N
SMILESC1C(ON=C1C2=CC(=CC=C2)OC3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)