CAS 6552-62-1 is the registry number for 3-(4-Methoxyphenyl)-1-(4-nitrophenyl)prop-2-en-1-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(4-methoxyphenyl)-1-(4-nitrophenyl)prop-2-en-1-one (CAS 6552-62-1) is a chemical compound with the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. IUPAC name: (E)-3-(4-methoxyphenyl)-1-(4-nitrophenyl)prop-2-en-1-one. InChIKey: OEFOVQFJRDIUTL-NYYWCZLTSA-N.
| Molecular formula | C16H13NO4 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | (E)-3-(4-methoxyphenyl)-1-(4-nitrophenyl)prop-2-en-1-one |
| InChIKey | OEFOVQFJRDIUTL-NYYWCZLTSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)