CAS 1283693-43-5 is the registry number for 2-(3,4-Dimethoxyphenyl)benzo[d]oxazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carbaldehyde (CAS 1283693-43-5) is a chemical compound with the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carbaldehyde. InChIKey: XYYHTUORHLHPTE-UHFFFAOYSA-N.
| Molecular formula | C16H13NO4 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-1,3-benzoxazole-5-carbaldehyde |
| InChIKey | XYYHTUORHLHPTE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC3=C(O2)C=CC(=C3)C=O)OC |
Computed by PubChem (NCBI)