CAS 1038374-69-4 is the registry number for N-Mesityl-2-aminobenzothiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
N-(2,4,6-trimethylphenyl)-1,3-benzothiazol-2-amine (CAS 1038374-69-4) is a chemical compound with the molecular formula C16H16N2S and a molecular weight of 268.4 g/mol. IUPAC name: N-(2,4,6-trimethylphenyl)-1,3-benzothiazol-2-amine. InChIKey: USXOQOIJQVFFTB-UHFFFAOYSA-N.
| Molecular formula | C16H16N2S |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | N-(2,4,6-trimethylphenyl)-1,3-benzothiazol-2-amine |
| InChIKey | USXOQOIJQVFFTB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC2=NC3=CC=CC=C3S2)C |
Computed by PubChem (NCBI)