CAS 736152-34-4 is the registry number for N-Benzyl-5,7-dimethyl-1,3-benzothiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
N-benzyl-5,7-dimethyl-1,3-benzothiazol-2-amine (CAS 736152-34-4) is a chemical compound with the molecular formula C16H16N2S and a molecular weight of 268.4 g/mol. IUPAC name: N-benzyl-5,7-dimethyl-1,3-benzothiazol-2-amine. InChIKey: HILBZYHLBNQVDI-UHFFFAOYSA-N.
| Molecular formula | C16H16N2S |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | N-benzyl-5,7-dimethyl-1,3-benzothiazol-2-amine |
| InChIKey | HILBZYHLBNQVDI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)N=C(S2)NCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)