CAS 748777-75-5 appears in our catalog under these names: Benzyl-(4,6-dimethyl-benzothiazol-2-yl)-amine, 95%, N-Benzyl-4,6-dimethyl-1,3-benzothiazol-2-amine, 95%, N-Benzyl-4,6-dimethyl-1,3-benzothiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
N-benzyl-4,6-dimethyl-1,3-benzothiazol-2-amine (CAS 748777-75-5) is a chemical compound with the molecular formula C16H16N2S and a molecular weight of 268.4 g/mol. IUPAC name: N-benzyl-4,6-dimethyl-1,3-benzothiazol-2-amine. InChIKey: ZLWZQKHVKYVBNX-UHFFFAOYSA-N.
| Molecular formula | C16H16N2S |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | N-benzyl-4,6-dimethyl-1,3-benzothiazol-2-amine |
| InChIKey | ZLWZQKHVKYVBNX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)SC(=N2)NCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)